C18H32N2O6 — CID 138521001
bicyclo[2.2.0]hexane;(2-ethylpiperazin-1-yl)-[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanone (PubChem CID 138521001) has the molecular formula C18H32N2O6 and a molecular weight of 372.46 g/mol. Its IUPAC name is bicyclo[2.2.0]hexane;(2-ethylpiperazin-1-yl)-[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanone.
| Compound Name | bicyclo[2.2.0]hexane;(2-ethylpiperazin-1-yl)-[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 138521001 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | bicyclo[2.2.0]hexane;(2-ethylpiperazin-1-yl)-[(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanone |
| SMILES | C1CC2CCC12.CCC1CNCCN1C(=O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H22N2O6.C6H10/c1-2-6-5-13-3-4-14(6)11(18)10-8(16)7(15)9(17)12(19)20-10;1-2-6-4-3-5(1)6/h6-10,12-13,15-17,19H,2-5H2,1H3;5-6H,1-4H2/t6?,7-,8-,9+,10-,12?;/m0./s1 |
| InChIKey | RFVOHIZMKFSXHH-BQOFEFOQSA-N |
| XLogP | -1.20 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |