C10H25N3O2 — CID 174720092
acetic acid;azane;1,2-diethylpiperazine (PubChem CID 174720092) has the molecular formula C10H25N3O2 and a molecular weight of 219.33 g/mol. Its IUPAC name is acetic acid;azane;1,2-diethylpiperazine.
| Compound Name | acetic acid;azane;1,2-diethylpiperazine |
|---|---|
| PubChem CID | 174720092 |
| Molecular Formula | C10H25N3O2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | acetic acid;azane;1,2-diethylpiperazine |
| SMILES | CC(=O)O.CCC1CNCCN1CC.N |
| InChI | InChI=1S/C8H18N2.C2H4O2.H3N/c1-3-8-7-9-5-6-10(8)4-2;1-2(3)4;/h8-9H,3-7H2,1-2H3;1H3,(H,3,4);1H3 |
| InChIKey | NIGWVCZHXAMMSG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |