acetic acid;azane;1,2-diethylpiperazine

C10H25N3O2 — CID 174720092

IUPACacetic acid;azane;1,2-diethylpiperazine
SMILESCC(=O)O.CCC1CNCCN1CC.N
InChIInChI=1S/C8H18N2.C2H4O2.H3N/c1-3-8-7-9-5-6-10(8)4-2;1-2(3)4;/h8-9H,3-7H2,1-2H3;1H3,(H,3,4);1H3
InChIKeyNIGWVCZHXAMMSG-UHFFFAOYSA-N
MW219.33 g/mol
LogP0.94
Rot. Bonds2

About acetic acid;azane;1,2-diethylpiperazine

acetic acid;azane;1,2-diethylpiperazine (PubChem CID 174720092) has the molecular formula C10H25N3O2 and a molecular weight of 219.33 g/mol. Its IUPAC name is acetic acid;azane;1,2-diethylpiperazine.

Molecular Properties

Compound Nameacetic acid;azane;1,2-diethylpiperazine
PubChem CID174720092
Molecular FormulaC10H25N3O2
Molecular Weight219.33 g/mol
Exact Mass219.19
IUPAC Nameacetic acid;azane;1,2-diethylpiperazine
SMILESCC(=O)O.CCC1CNCCN1CC.N
InChIInChI=1S/C8H18N2.C2H4O2.H3N/c1-3-8-7-9-5-6-10(8)4-2;1-2(3)4;/h8-9H,3-7H2,1-2H3;1H3,(H,3,4);1H3
InChIKeyNIGWVCZHXAMMSG-UHFFFAOYSA-N
XLogP0.94
TPSA87.57 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.33
LogP ≤ 50.94
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze acetic acid;azane;1,2-diethylpiperazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;azane;1,2-diethylpiperazine?
The IUPAC name of acetic acid;azane;1,2-diethylpiperazine (CID 174720092) is acetic acid;azane;1,2-diethylpiperazine.
What is the SMILES notation for acetic acid;azane;1,2-diethylpiperazine?
The canonical SMILES for acetic acid;azane;1,2-diethylpiperazine is CC(=O)O.CCC1CNCCN1CC.N.
What is the InChIKey of acetic acid;azane;1,2-diethylpiperazine?
The InChIKey is NIGWVCZHXAMMSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.C2H4O2.H3N/c1-3-8-7-9-5-6-10(8)4-2;1-2(3)4;/h8-9H,3-7H2,1-2H3;1H3,(H,3,4);1H3.
What are the key properties of acetic acid;azane;1,2-diethylpiperazine?
acetic acid;azane;1,2-diethylpiperazine has a molecular weight of 219.33 g/mol, XLogP of 0.94, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;azane;1,2-diethylpiperazine is sourced from PubChem (CID 174720092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).