C9H17F3N2O2 — CID 146455396
(2R)-1-ethyl-2-methylpiperazine;2,2,2-trifluoroacetic acid (PubChem CID 146455396) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is (2R)-1-ethyl-2-methylpiperazine;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-1-ethyl-2-methylpiperazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146455396 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2R)-1-ethyl-2-methylpiperazine;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCNC[C@H]1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H16N2.C2HF3O2/c1-3-9-5-4-8-6-7(9)2;3-2(4,5)1(6)7/h7-8H,3-6H2,1-2H3;(H,6,7)/t7-;/m1./s1 |
| InChIKey | IGBBTYJVMNPUCN-OGFXRTJISA-N |
| XLogP | 0.93 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |