About 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine
5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine (PubChem CID 138522394) has the molecular formula C8H8BrN5S
and a molecular weight of 286.16 g/mol. Its IUPAC name is 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine |
| PubChem CID | 138522394 |
| Molecular Formula | C8H8BrN5S |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine |
| SMILES | Nc1ncc(Br)cc1NCc1cnns1 |
| InChI | InChI=1S/C8H8BrN5S/c9-5-1-7(8(10)12-2-5)11-3-6-4-13-14-15-6/h1-2,4,11H,3H2,(H2,10,12) |
| InChIKey | NTFATXHRTCUXAL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine?
The IUPAC name of 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine (CID 138522394) is 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine.
What is the SMILES notation for 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine?
The canonical SMILES for 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine is Nc1ncc(Br)cc1NCc1cnns1.
What is the InChIKey of 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine?
The InChIKey is NTFATXHRTCUXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN5S/c9-5-1-7(8(10)12-2-5)11-3-6-4-13-14-15-6/h1-2,4,11H,3H2,(H2,10,12).
What are the key properties of 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine?
5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine has a molecular weight of 286.16 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-N-(thiadiazol-5-ylmethyl)pyridine-2,3-diamine is sourced from PubChem (CID 138522394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).