C12H17BrN4O2 — CID 176975771
3-[(2-amino-5-bromo-3-pyridinyl)amino]-2,2-dimethylpropanenitrile;methyl formate (PubChem CID 176975771) has the molecular formula C12H17BrN4O2 and a molecular weight of 329.20 g/mol. Its IUPAC name is 3-[(2-amino-5-bromo-3-pyridinyl)amino]-2,2-dimethylpropanenitrile;methyl formate.
| Compound Name | 3-[(2-amino-5-bromo-3-pyridinyl)amino]-2,2-dimethylpropanenitrile;methyl formate |
|---|---|
| PubChem CID | 176975771 |
| Molecular Formula | C12H17BrN4O2 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 3-[(2-amino-5-bromo-3-pyridinyl)amino]-2,2-dimethylpropanenitrile;methyl formate |
| SMILES | CC(C)(C#N)CNc1cc(Br)cnc1N.COC=O |
| InChI | InChI=1S/C10H13BrN4.C2H4O2/c1-10(2,5-12)6-15-8-3-7(11)4-14-9(8)13;1-4-2-3/h3-4,15H,6H2,1-2H3,(H2,13,14);2H,1H3 |
| InChIKey | RVQQIWPAZFYMAK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|