C9H12BrNO2 — CID 177034654
5-bromo-2,3-dimethylpyridine;methyl formate (PubChem CID 177034654) has the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. Its IUPAC name is 5-bromo-2,3-dimethylpyridine;methyl formate.
| Compound Name | 5-bromo-2,3-dimethylpyridine;methyl formate |
|---|---|
| PubChem CID | 177034654 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 5-bromo-2,3-dimethylpyridine;methyl formate |
| SMILES | COC=O.Cc1cc(Br)cnc1C |
| InChI | InChI=1S/C7H8BrN.C2H4O2/c1-5-3-7(8)4-9-6(5)2;1-4-2-3/h3-4H,1-2H3;2H,1H3 |
| InChIKey | ZFZYJWZWIPHRIH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|