About 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane
5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane (PubChem CID 157258711) has the molecular formula C15H19Br2IN2O
and a molecular weight of 530.04 g/mol. Its IUPAC name is 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane.
Molecular Properties
| Compound Name | 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane |
| PubChem CID | 157258711 |
| Molecular Formula | C15H19Br2IN2O |
| Molecular Weight | 530.04 g/mol |
| Exact Mass | 527.89 |
| IUPAC Name | 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane |
| SMILES | C.C.Cc1cc(Br)cnc1C=O.Cc1cc(Br)cnc1I |
| InChI | InChI=1S/C7H6BrNO.C6H5BrIN.2CH4/c1-5-2-6(8)3-9-7(5)4-10;1-4-2-5(7)3-9-6(4)8;;/h2-4H,1H3;2-3H,1H3;2*1H4 |
| InChIKey | AXEVQOIAAISNKO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.04 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane?
The IUPAC name of 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane (CID 157258711) is 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane.
What is the SMILES notation for 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane?
The canonical SMILES for 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane is C.C.Cc1cc(Br)cnc1C=O.Cc1cc(Br)cnc1I.
What is the InChIKey of 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane?
The InChIKey is AXEVQOIAAISNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO.C6H5BrIN.2CH4/c1-5-2-6(8)3-9-7(5)4-10;1-4-2-5(7)3-9-6(4)8;;/h2-4H,1H3;2-3H,1H3;2*1H4.
What are the key properties of 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane?
5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane has a molecular weight of 530.04 g/mol, XLogP of 5.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-iodo-3-methylpyridine;5-bromo-3-methylpyridine-2-carbaldehyde;methane is sourced from PubChem (CID 157258711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).