C11H15F3N4O2S — CID 138522937
ethyl 2-methylsulfanyl-4-[2-(1,1,1-trifluoropropan-2-yl)hydrazinyl]pyrimidine-5-carboxylate (PubChem CID 138522937) has the molecular formula C11H15F3N4O2S and a molecular weight of 324.33 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-[2-(1,1,1-trifluoropropan-2-yl)hydrazinyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-[2-(1,1,1-trifluoropropan-2-yl)hydrazinyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 138522937 |
| Molecular Formula | C11H15F3N4O2S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-[2-(1,1,1-trifluoropropan-2-yl)hydrazinyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1NNC(C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N4O2S/c1-4-20-9(19)7-5-15-10(21-3)16-8(7)18-17-6(2)11(12,13)14/h5-6,17H,4H2,1-3H3,(H,15,16,18) |
| InChIKey | VBOHEQBWGTXQNK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|