C13H23NO6 — CID 138523303
(2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-N-heptyl-2-hydroxyacetamide (PubChem CID 138523303) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-N-heptyl-2-hydroxyacetamide.
| Compound Name | (2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-N-heptyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 138523303 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-N-heptyl-2-hydroxyacetamide |
| SMILES | CCCCCCCNC(=O)[C@H](O)[C@H]1OC(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H23NO6/c1-2-3-4-5-6-7-14-12(18)10(17)11-8(15)9(16)13(19)20-11/h8-11,15-17H,2-7H2,1H3,(H,14,18)/t8-,9+,10-,11+/m1/s1 |
| InChIKey | QTPYSILBQNEABW-YTWAJWBKSA-N |
| XLogP | -0.92 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|