C19H21N3O5 — CID 138523405
4-[[(2S)-3-methyl-2-(quinoline-2-carbonylamino)butanoyl]amino]-4-oxobutanoic acid (PubChem CID 138523405) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-[[(2S)-3-methyl-2-(quinoline-2-carbonylamino)butanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-3-methyl-2-(quinoline-2-carbonylamino)butanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 138523405 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[[(2S)-3-methyl-2-(quinoline-2-carbonylamino)butanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1ccc2ccccc2n1)C(=O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C19H21N3O5/c1-11(2)17(19(27)21-15(23)9-10-16(24)25)22-18(26)14-8-7-12-5-3-4-6-13(12)20-14/h3-8,11,17H,9-10H2,1-2H3,(H,22,26)(H,24,25)(H,21,23,27)/t17-/m0/s1 |
| InChIKey | QCOHBLVQTNXMHD-KRWDZBQOSA-N |
| XLogP | 1.50 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |