C19H24BrN5O — CID 138523815
3-amino-4-[[4-(2-amino-3-bromoanilino)-2,3-dimethylbut-2-enyl]amino]benzamide (PubChem CID 138523815) has the molecular formula C19H24BrN5O and a molecular weight of 418.34 g/mol. Its IUPAC name is 3-amino-4-[[4-(2-amino-3-bromoanilino)-2,3-dimethylbut-2-enyl]amino]benzamide.
| Compound Name | 3-amino-4-[[4-(2-amino-3-bromoanilino)-2,3-dimethylbut-2-enyl]amino]benzamide |
|---|---|
| PubChem CID | 138523815 |
| Molecular Formula | C19H24BrN5O |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-amino-4-[[4-(2-amino-3-bromoanilino)-2,3-dimethylbut-2-enyl]amino]benzamide |
| SMILES | CC(CNc1ccc(C(N)=O)cc1N)=C(C)CNc1cccc(Br)c1N |
| InChI | InChI=1S/C19H24BrN5O/c1-11(9-24-16-7-6-13(19(23)26)8-15(16)21)12(2)10-25-17-5-3-4-14(20)18(17)22/h3-8,24-25H,9-10,21-22H2,1-2H3,(H2,23,26) |
| InChIKey | BMHSFKAYJDNTGM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|