C18H24N6O2 — CID 156790437
3-amino-4-[2-[4-carbamoyl-2-(methylamino)anilino]ethylamino]-N-methylbenzamide (PubChem CID 156790437) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-amino-4-[2-[4-carbamoyl-2-(methylamino)anilino]ethylamino]-N-methylbenzamide.
| Compound Name | 3-amino-4-[2-[4-carbamoyl-2-(methylamino)anilino]ethylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 156790437 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-amino-4-[2-[4-carbamoyl-2-(methylamino)anilino]ethylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCCNc2ccc(C(N)=O)cc2NC)c(N)c1 |
| InChI | InChI=1S/C18H24N6O2/c1-21-16-10-11(17(20)25)3-6-15(16)24-8-7-23-14-5-4-12(9-13(14)19)18(26)22-2/h3-6,9-10,21,23-24H,7-8,19H2,1-2H3,(H2,20,25)(H,22,26) |
| InChIKey | NUMFLWLDFRNZKC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|