C12H19N3O3 — CID 82989279
3-amino-4-[2-(2-hydroxyethoxy)ethylamino]-N-methylbenzamide (PubChem CID 82989279) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-amino-4-[2-(2-hydroxyethoxy)ethylamino]-N-methylbenzamide.
| Compound Name | 3-amino-4-[2-(2-hydroxyethoxy)ethylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 82989279 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-amino-4-[2-(2-hydroxyethoxy)ethylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCCOCCO)c(N)c1 |
| InChI | InChI=1S/C12H19N3O3/c1-14-12(17)9-2-3-11(10(13)8-9)15-4-6-18-7-5-16/h2-3,8,15-16H,4-7,13H2,1H3,(H,14,17) |
| InChIKey | HOLJLJDFVMIUOJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|