C19H22ClIN2O3 — CID 138523941
[1-(6-chloro-2-iodo-5-phenylmethoxy-3-pyridinyl)-3,3-dimethylbutan-2-yl]carbamic acid (PubChem CID 138523941) has the molecular formula C19H22ClIN2O3 and a molecular weight of 488.75 g/mol. Its IUPAC name is [1-(6-chloro-2-iodo-5-phenylmethoxy-3-pyridinyl)-3,3-dimethylbutan-2-yl]carbamic acid.
| Compound Name | [1-(6-chloro-2-iodo-5-phenylmethoxy-3-pyridinyl)-3,3-dimethylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 138523941 |
| Molecular Formula | C19H22ClIN2O3 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | [1-(6-chloro-2-iodo-5-phenylmethoxy-3-pyridinyl)-3,3-dimethylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(C)C(Cc1cc(OCc2ccccc2)c(Cl)nc1I)NC(=O)O |
| InChI | InChI=1S/C19H22ClIN2O3/c1-19(2,3)15(22-18(24)25)10-13-9-14(16(20)23-17(13)21)26-11-12-7-5-4-6-8-12/h4-9,15,22H,10-11H2,1-3H3,(H,24,25) |
| InChIKey | JGLJVIZNQOGZGR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|