C30H36ClIN2O6 — CID 175042193
ethyl 1-[1-[6-chloro-2-iodo-5-(3-methoxypropoxy)-3-pyridinyl]-3,3-dimethylbutan-2-yl]-4-oxo-5-phenylmethoxypyridine-3-carboxylate (PubChem CID 175042193) has the molecular formula C30H36ClIN2O6 and a molecular weight of 682.98 g/mol. Its IUPAC name is ethyl 1-[1-[6-chloro-2-iodo-5-(3-methoxypropoxy)-3-pyridinyl]-3,3-dimethylbutan-2-yl]-4-oxo-5-phenylmethoxypyridine-3-carboxylate.
| Compound Name | ethyl 1-[1-[6-chloro-2-iodo-5-(3-methoxypropoxy)-3-pyridinyl]-3,3-dimethylbutan-2-yl]-4-oxo-5-phenylmethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 175042193 |
| Molecular Formula | C30H36ClIN2O6 |
| Molecular Weight | 682.98 g/mol |
| Exact Mass | 682.13 |
| IUPAC Name | ethyl 1-[1-[6-chloro-2-iodo-5-(3-methoxypropoxy)-3-pyridinyl]-3,3-dimethylbutan-2-yl]-4-oxo-5-phenylmethoxypyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C(Cc2cc(OCCCOC)c(Cl)nc2I)C(C)(C)C)cc(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C30H36ClIN2O6/c1-6-38-29(36)22-17-34(18-24(26(22)35)40-19-20-11-8-7-9-12-20)25(30(2,3)4)16-21-15-23(27(31)33-28(21)32)39-14-10-13-37-5/h7-9,11-12,15,17-18,25H,6,10,13-14,16,19H2,1-5H3 |
| InChIKey | SSQIXWHJJHLKMA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.98 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|