C24H30ClIN2O6 — CID 139462501
ethyl 1-[5-[[6-chloro-2-iodo-5-(3-methoxypropoxy)-3-pyridinyl]oxy]-2,2-dimethylcyclopentyl]-4-oxopyridine-3-carboxylate (PubChem CID 139462501) has the molecular formula C24H30ClIN2O6 and a molecular weight of 604.87 g/mol. Its IUPAC name is ethyl 1-[5-[[6-chloro-2-iodo-5-(3-methoxypropoxy)-3-pyridinyl]oxy]-2,2-dimethylcyclopentyl]-4-oxopyridine-3-carboxylate.
| Compound Name | ethyl 1-[5-[[6-chloro-2-iodo-5-(3-methoxypropoxy)-3-pyridinyl]oxy]-2,2-dimethylcyclopentyl]-4-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 139462501 |
| Molecular Formula | C24H30ClIN2O6 |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | ethyl 1-[5-[[6-chloro-2-iodo-5-(3-methoxypropoxy)-3-pyridinyl]oxy]-2,2-dimethylcyclopentyl]-4-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2C(Oc3cc(OCCCOC)c(Cl)nc3I)CCC2(C)C)ccc1=O |
| InChI | InChI=1S/C24H30ClIN2O6/c1-5-32-23(30)15-14-28(10-8-16(15)29)20-17(7-9-24(20,2)3)34-19-13-18(21(25)27-22(19)26)33-12-6-11-31-4/h8,10,13-14,17,20H,5-7,9,11-12H2,1-4H3 |
| InChIKey | OXBQPMURCDFPSY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|