C21H24ClIN2O6 — CID 138524023
ethyl 1-[4-acetyloxy-1-(6-chloro-5-hydroxy-2-iodo-3-pyridinyl)-3,3-dimethylbutan-2-yl]-4-oxopyridine-3-carboxylate (PubChem CID 138524023) has the molecular formula C21H24ClIN2O6 and a molecular weight of 562.79 g/mol. Its IUPAC name is ethyl 1-[4-acetyloxy-1-(6-chloro-5-hydroxy-2-iodo-3-pyridinyl)-3,3-dimethylbutan-2-yl]-4-oxopyridine-3-carboxylate.
| Compound Name | ethyl 1-[4-acetyloxy-1-(6-chloro-5-hydroxy-2-iodo-3-pyridinyl)-3,3-dimethylbutan-2-yl]-4-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 138524023 |
| Molecular Formula | C21H24ClIN2O6 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | ethyl 1-[4-acetyloxy-1-(6-chloro-5-hydroxy-2-iodo-3-pyridinyl)-3,3-dimethylbutan-2-yl]-4-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C(Cc2cc(O)c(Cl)nc2I)C(C)(C)COC(C)=O)ccc1=O |
| InChI | InChI=1S/C21H24ClIN2O6/c1-5-30-20(29)14-10-25(7-6-15(14)27)17(21(3,4)11-31-12(2)26)9-13-8-16(28)18(22)24-19(13)23/h6-8,10,17,28H,5,9,11H2,1-4H3 |
| InChIKey | OMFXERSTTZUTSH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|