C28H34BrClN2O9 — CID 140905890
ethyl 1-[2,2-bis(acetyloxymethyl)-5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]pyrrolidin-1-yl]-4-oxopyridine-3-carboxylate (PubChem CID 140905890) has the molecular formula C28H34BrClN2O9 and a molecular weight of 657.94 g/mol. Its IUPAC name is ethyl 1-[2,2-bis(acetyloxymethyl)-5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]pyrrolidin-1-yl]-4-oxopyridine-3-carboxylate.
| Compound Name | ethyl 1-[2,2-bis(acetyloxymethyl)-5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]pyrrolidin-1-yl]-4-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 140905890 |
| Molecular Formula | C28H34BrClN2O9 |
| Molecular Weight | 657.94 g/mol |
| Exact Mass | 656.11 |
| IUPAC Name | ethyl 1-[2,2-bis(acetyloxymethyl)-5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]pyrrolidin-1-yl]-4-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(N2C(c3cc(OCCCOC)c(Cl)cc3Br)CCC2(COC(C)=O)COC(C)=O)ccc1=O |
| InChI | InChI=1S/C28H34BrClN2O9/c1-5-38-27(36)21-15-31(10-8-25(21)35)32-24(7-9-28(32,16-40-18(2)33)17-41-19(3)34)20-13-26(23(30)14-22(20)29)39-12-6-11-37-4/h8,10,13-15,24H,5-7,9,11-12,16-17H2,1-4H3 |
| InChIKey | LPSFEZZFZNPOEB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 122.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.94 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|