C23H22ClNO6S — CID 146330498
ethyl 2-chloro-3-(3-methoxypropoxy)-10-oxo-6-thiophen-2-yl-6H-pyrido[1,2-c][1,3]benzoxazine-9-carboxylate (PubChem CID 146330498) has the molecular formula C23H22ClNO6S and a molecular weight of 475.95 g/mol. Its IUPAC name is ethyl 2-chloro-3-(3-methoxypropoxy)-10-oxo-6-thiophen-2-yl-6H-pyrido[1,2-c][1,3]benzoxazine-9-carboxylate.
| Compound Name | ethyl 2-chloro-3-(3-methoxypropoxy)-10-oxo-6-thiophen-2-yl-6H-pyrido[1,2-c][1,3]benzoxazine-9-carboxylate |
|---|---|
| PubChem CID | 146330498 |
| Molecular Formula | C23H22ClNO6S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | ethyl 2-chloro-3-(3-methoxypropoxy)-10-oxo-6-thiophen-2-yl-6H-pyrido[1,2-c][1,3]benzoxazine-9-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(Cl)c(OCCCOC)cc1OC2c1cccs1 |
| InChI | InChI=1S/C23H22ClNO6S/c1-3-29-23(27)15-13-25-17(11-18(15)26)14-10-16(24)20(30-8-5-7-28-2)12-19(14)31-22(25)21-6-4-9-32-21/h4,6,9-13,22H,3,5,7-8H2,1-2H3 |
| InChIKey | WMTDMIBBUURLFE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|