C23H23NO6S — CID 158537283
9-acetyl-2-methoxy-3-(3-methoxypropoxy)-6-thiophen-2-yl-6H-pyrido[1,2-c][1,3]benzoxazin-10-one (PubChem CID 158537283) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is 9-acetyl-2-methoxy-3-(3-methoxypropoxy)-6-thiophen-2-yl-6H-pyrido[1,2-c][1,3]benzoxazin-10-one.
| Compound Name | 9-acetyl-2-methoxy-3-(3-methoxypropoxy)-6-thiophen-2-yl-6H-pyrido[1,2-c][1,3]benzoxazin-10-one |
|---|---|
| PubChem CID | 158537283 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 9-acetyl-2-methoxy-3-(3-methoxypropoxy)-6-thiophen-2-yl-6H-pyrido[1,2-c][1,3]benzoxazin-10-one |
| SMILES | COCCCOc1cc2c(cc1OC)-c1cc(=O)c(C(C)=O)cn1C(c1cccs1)O2 |
| InChI | InChI=1S/C23H23NO6S/c1-14(25)16-13-24-17(11-18(16)26)15-10-20(28-3)21(29-8-5-7-27-2)12-19(15)30-23(24)22-6-4-9-31-22/h4,6,9-13,23H,5,7-8H2,1-3H3 |
| InChIKey | HMLFIAFVXDNCME-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|