C26H30N2O7S — CID 122457108
9-(6-aminohexoxy)-10-methoxy-2-oxo-6-thiophen-2-yl-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid;formic acid (PubChem CID 122457108) has the molecular formula C26H30N2O7S and a molecular weight of 514.60 g/mol. Its IUPAC name is 9-(6-aminohexoxy)-10-methoxy-2-oxo-6-thiophen-2-yl-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid;formic acid.
| Compound Name | 9-(6-aminohexoxy)-10-methoxy-2-oxo-6-thiophen-2-yl-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 122457108 |
| Molecular Formula | C26H30N2O7S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 9-(6-aminohexoxy)-10-methoxy-2-oxo-6-thiophen-2-yl-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid;formic acid |
| SMILES | COc1cc2c(cc1OCCCCCCN)CC(c1cccs1)n1cc(C(=O)O)c(=O)cc1-2.O=CO |
| InChI | InChI=1S/C25H28N2O5S.CH2O2/c1-31-22-13-17-16(12-23(22)32-9-5-3-2-4-8-26)11-20(24-7-6-10-33-24)27-15-18(25(29)30)21(28)14-19(17)27;2-1-3/h6-7,10,12-15,20H,2-5,8-9,11,26H2,1H3,(H,29,30);1H,(H,2,3) |
| InChIKey | FYEIFNPUMQKWFM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|