C17H23BrClNO3 — CID 135296720
(NE)-N-[5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]-2,2-dimethylcyclopentylidene]hydroxylamine (PubChem CID 135296720) has the molecular formula C17H23BrClNO3 and a molecular weight of 404.73 g/mol. Its IUPAC name is (NE)-N-[5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]-2,2-dimethylcyclopentylidene]hydroxylamine.
| Compound Name | (NE)-N-[5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]-2,2-dimethylcyclopentylidene]hydroxylamine |
|---|---|
| PubChem CID | 135296720 |
| Molecular Formula | C17H23BrClNO3 |
| Molecular Weight | 404.73 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (NE)-N-[5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]-2,2-dimethylcyclopentylidene]hydroxylamine |
| SMILES | COCCCOc1cc(C2CCC(C)(C)/C2=N/O)c(Br)cc1Cl |
| InChI | InChI=1S/C17H23BrClNO3/c1-17(2)6-5-11(16(17)20-21)12-9-15(14(19)10-13(12)18)23-8-4-7-22-3/h9-11,21H,4-8H2,1-3H3/b20-16+ |
| InChIKey | XYOGDHDFPDWWCE-CAPFRKAQSA-N |
| XLogP | 5.25 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|