C16H22BrClN2O3 — CID 135296683
5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]-2,2-dimethyl-1-nitrosopyrrolidine (PubChem CID 135296683) has the molecular formula C16H22BrClN2O3 and a molecular weight of 405.72 g/mol. Its IUPAC name is 5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]-2,2-dimethyl-1-nitrosopyrrolidine.
| Compound Name | 5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]-2,2-dimethyl-1-nitrosopyrrolidine |
|---|---|
| PubChem CID | 135296683 |
| Molecular Formula | C16H22BrClN2O3 |
| Molecular Weight | 405.72 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]-2,2-dimethyl-1-nitrosopyrrolidine |
| SMILES | COCCCOc1cc(C2CCC(C)(C)N2N=O)c(Br)cc1Cl |
| InChI | InChI=1S/C16H22BrClN2O3/c1-16(2)6-5-14(20(16)19-21)11-9-15(13(18)10-12(11)17)23-8-4-7-22-3/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | XFSLREABFPYDBP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|