C19H22BrClN2O — CID 135290299
(5S)-5-(2-bromo-4-chloro-5-phenylmethoxyphenyl)-2,2-dimethylpyrrolidin-1-amine (PubChem CID 135290299) has the molecular formula C19H22BrClN2O and a molecular weight of 409.76 g/mol. Its IUPAC name is (5S)-5-(2-bromo-4-chloro-5-phenylmethoxyphenyl)-2,2-dimethylpyrrolidin-1-amine.
| Compound Name | (5S)-5-(2-bromo-4-chloro-5-phenylmethoxyphenyl)-2,2-dimethylpyrrolidin-1-amine |
|---|---|
| PubChem CID | 135290299 |
| Molecular Formula | C19H22BrClN2O |
| Molecular Weight | 409.76 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (5S)-5-(2-bromo-4-chloro-5-phenylmethoxyphenyl)-2,2-dimethylpyrrolidin-1-amine |
| SMILES | CC1(C)CC[C@@H](c2cc(OCc3ccccc3)c(Cl)cc2Br)N1N |
| InChI | InChI=1S/C19H22BrClN2O/c1-19(2)9-8-17(23(19)22)14-10-18(16(21)11-15(14)20)24-12-13-6-4-3-5-7-13/h3-7,10-11,17H,8-9,12,22H2,1-2H3/t17-/m0/s1 |
| InChIKey | QZYLRFHVZKWXAU-KRWDZBQOSA-N |
| XLogP | 5.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|