C21H25BrN2O2 — CID 146515361
5-(4-bromo-7-phenylmethoxy-2,3-dihydro-1-benzofuran-5-yl)-2,2-dimethylpyrrolidin-1-amine (PubChem CID 146515361) has the molecular formula C21H25BrN2O2 and a molecular weight of 417.35 g/mol. Its IUPAC name is 5-(4-bromo-7-phenylmethoxy-2,3-dihydro-1-benzofuran-5-yl)-2,2-dimethylpyrrolidin-1-amine.
| Compound Name | 5-(4-bromo-7-phenylmethoxy-2,3-dihydro-1-benzofuran-5-yl)-2,2-dimethylpyrrolidin-1-amine |
|---|---|
| PubChem CID | 146515361 |
| Molecular Formula | C21H25BrN2O2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 5-(4-bromo-7-phenylmethoxy-2,3-dihydro-1-benzofuran-5-yl)-2,2-dimethylpyrrolidin-1-amine |
| SMILES | CC1(C)CCC(c2cc(OCc3ccccc3)c3c(c2Br)CCO3)N1N |
| InChI | InChI=1S/C21H25BrN2O2/c1-21(2)10-8-17(24(21)23)16-12-18(20-15(19(16)22)9-11-25-20)26-13-14-6-4-3-5-7-14/h3-7,12,17H,8-11,13,23H2,1-2H3 |
| InChIKey | HTALONNWCJMPAN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|