C21H24N2O3 — CID 146515899
2,2-dimethyl-1-nitroso-5-(7-phenylmethoxy-2,3-dihydro-1-benzofuran-5-yl)pyrrolidine (PubChem CID 146515899) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2,2-dimethyl-1-nitroso-5-(7-phenylmethoxy-2,3-dihydro-1-benzofuran-5-yl)pyrrolidine.
| Compound Name | 2,2-dimethyl-1-nitroso-5-(7-phenylmethoxy-2,3-dihydro-1-benzofuran-5-yl)pyrrolidine |
|---|---|
| PubChem CID | 146515899 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2,2-dimethyl-1-nitroso-5-(7-phenylmethoxy-2,3-dihydro-1-benzofuran-5-yl)pyrrolidine |
| SMILES | CC1(C)CCC(c2cc3c(c(OCc4ccccc4)c2)OCC3)N1N=O |
| InChI | InChI=1S/C21H24N2O3/c1-21(2)10-8-18(23(21)22-24)17-12-16-9-11-25-20(16)19(13-17)26-14-15-6-4-3-5-7-15/h3-7,12-13,18H,8-11,14H2,1-2H3 |
| InChIKey | SFXLSBVCDUGSEH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|