C17H16ClIO2 — CID 175163587
6-(chloromethyl)-5-iodo-8-phenylmethoxy-3,4-dihydro-2H-chromene (PubChem CID 175163587) has the molecular formula C17H16ClIO2 and a molecular weight of 414.67 g/mol. Its IUPAC name is 6-(chloromethyl)-5-iodo-8-phenylmethoxy-3,4-dihydro-2H-chromene.
| Compound Name | 6-(chloromethyl)-5-iodo-8-phenylmethoxy-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 175163587 |
| Molecular Formula | C17H16ClIO2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 6-(chloromethyl)-5-iodo-8-phenylmethoxy-3,4-dihydro-2H-chromene |
| SMILES | ClCc1cc(OCc2ccccc2)c2c(c1I)CCCO2 |
| InChI | InChI=1S/C17H16ClIO2/c18-10-13-9-15(21-11-12-5-2-1-3-6-12)17-14(16(13)19)7-4-8-20-17/h1-3,5-6,9H,4,7-8,10-11H2 |
| InChIKey | UVXUURHZDBPKHW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|