C27H27ClN2O4 — CID 140905883
ethyl (6R)-10-chloro-3,3-dimethyl-15-oxo-9-phenylmethoxy-1,2-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylate (PubChem CID 140905883) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is ethyl (6R)-10-chloro-3,3-dimethyl-15-oxo-9-phenylmethoxy-1,2-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylate.
| Compound Name | ethyl (6R)-10-chloro-3,3-dimethyl-15-oxo-9-phenylmethoxy-1,2-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylate |
|---|---|
| PubChem CID | 140905883 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | ethyl (6R)-10-chloro-3,3-dimethyl-15-oxo-9-phenylmethoxy-1,2-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(Cl)c(OCc3ccccc3)cc1[C@H]1CCC(C)(C)N12 |
| InChI | InChI=1S/C27H27ClN2O4/c1-4-33-26(32)20-15-29-23(14-24(20)31)18-12-21(28)25(34-16-17-8-6-5-7-9-17)13-19(18)22-10-11-27(2,3)30(22)29/h5-9,12-15,22H,4,10-11,16H2,1-3H3/t22-/m1/s1 |
| InChIKey | MXSPQHUANHIVHP-JOCHJYFZSA-N |
| XLogP | 5.49 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |