C27H28N2O5 — CID 142409318
ethyl 9-methoxy-3,3-dimethyl-14-oxo-8-phenylmethoxy-1,2-diazatetracyclo[10.4.0.02,5.06,11]hexadeca-6,8,10,12,15-pentaene-15-carboxylate (PubChem CID 142409318) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is ethyl 9-methoxy-3,3-dimethyl-14-oxo-8-phenylmethoxy-1,2-diazatetracyclo[10.4.0.02,5.06,11]hexadeca-6,8,10,12,15-pentaene-15-carboxylate.
| Compound Name | ethyl 9-methoxy-3,3-dimethyl-14-oxo-8-phenylmethoxy-1,2-diazatetracyclo[10.4.0.02,5.06,11]hexadeca-6,8,10,12,15-pentaene-15-carboxylate |
|---|---|
| PubChem CID | 142409318 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | ethyl 9-methoxy-3,3-dimethyl-14-oxo-8-phenylmethoxy-1,2-diazatetracyclo[10.4.0.02,5.06,11]hexadeca-6,8,10,12,15-pentaene-15-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(OC)c(OCc3ccccc3)cc1C1CC(C)(C)N12 |
| InChI | InChI=1S/C27H28N2O5/c1-5-33-26(31)20-15-28-21(13-23(20)30)18-11-24(32-4)25(34-16-17-9-7-6-8-10-17)12-19(18)22-14-27(2,3)29(22)28/h6-13,15,22H,5,14,16H2,1-4H3 |
| InChIKey | WCUSZIYQEKVFMT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |