C28H38N2O5 — CID 126538009
ethyl (2R,6S)-9-(6-aminohexoxy)-10-methoxy-3,3-dimethyl-15-oxo-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylate (PubChem CID 126538009) has the molecular formula C28H38N2O5 and a molecular weight of 482.62 g/mol. Its IUPAC name is ethyl (2R,6S)-9-(6-aminohexoxy)-10-methoxy-3,3-dimethyl-15-oxo-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylate.
| Compound Name | ethyl (2R,6S)-9-(6-aminohexoxy)-10-methoxy-3,3-dimethyl-15-oxo-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylate |
|---|---|
| PubChem CID | 126538009 |
| Molecular Formula | C28H38N2O5 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | ethyl (2R,6S)-9-(6-aminohexoxy)-10-methoxy-3,3-dimethyl-15-oxo-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(OC)c(OCCCCCCN)cc1[C@@H]1CCC(C)(C)[C@@H]12 |
| InChI | InChI=1S/C28H38N2O5/c1-5-34-27(32)21-17-30-22(16-23(21)31)20-15-24(33-4)25(35-13-9-7-6-8-12-29)14-19(20)18-10-11-28(2,3)26(18)30/h14-18,26H,5-13,29H2,1-4H3/t18-,26+/m0/s1 |
| InChIKey | IJWYREVLWFMDSR-HFJWLAOPSA-N |
| XLogP | 5.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|