C27H37NO6 — CID 118279117
ethyl 7-butyl-9-(6-hydroxyhexoxy)-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 118279117) has the molecular formula C27H37NO6 and a molecular weight of 471.59 g/mol. Its IUPAC name is ethyl 7-butyl-9-(6-hydroxyhexoxy)-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 7-butyl-9-(6-hydroxyhexoxy)-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 118279117 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | ethyl 7-butyl-9-(6-hydroxyhexoxy)-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCCCC1Cn2cc(C(=O)OCC)c(=O)cc2-c2cc(OC)c(OCCCCCCO)cc21 |
| InChI | InChI=1S/C27H37NO6/c1-4-6-11-19-17-28-18-22(27(31)33-5-2)24(30)16-23(28)21-15-25(32-3)26(14-20(19)21)34-13-10-8-7-9-12-29/h14-16,18-19,29H,4-13,17H2,1-3H3 |
| InChIKey | HZEOTBHIIMXYRY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|