C25H31NO5 — CID 142415878
ethyl 9-(butoxymethyl)-10-methoxy-2-oxospiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-3-carboxylate (PubChem CID 142415878) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl 9-(butoxymethyl)-10-methoxy-2-oxospiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-3-carboxylate.
| Compound Name | ethyl 9-(butoxymethyl)-10-methoxy-2-oxospiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-3-carboxylate |
|---|---|
| PubChem CID | 142415878 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | ethyl 9-(butoxymethyl)-10-methoxy-2-oxospiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-3-carboxylate |
| SMILES | CCCCOCc1cc2c(cc1OC)-c1cc(=O)c(C(=O)OCC)cn1C1(CCC1)C2 |
| InChI | InChI=1S/C25H31NO5/c1-4-6-10-30-16-18-11-17-14-25(8-7-9-25)26-15-20(24(28)31-5-2)22(27)13-21(26)19(17)12-23(18)29-3/h11-13,15H,4-10,14,16H2,1-3H3 |
| InChIKey | TVZNLQWDZMDSII-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|