C23H23NO5 — CID 135314177
10-ethynyl-9-(3-methoxypropoxy)-2-oxospiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-3-carboxylic acid (PubChem CID 135314177) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 10-ethynyl-9-(3-methoxypropoxy)-2-oxospiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-3-carboxylic acid.
| Compound Name | 10-ethynyl-9-(3-methoxypropoxy)-2-oxospiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-3-carboxylic acid |
|---|---|
| PubChem CID | 135314177 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 10-ethynyl-9-(3-methoxypropoxy)-2-oxospiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-3-carboxylic acid |
| SMILES | C#Cc1cc2c(cc1OCCCOC)CC1(CCC1)n1cc(C(=O)O)c(=O)cc1-2 |
| InChI | InChI=1S/C23H23NO5/c1-3-15-10-17-16(11-21(15)29-9-5-8-28-2)13-23(6-4-7-23)24-14-18(22(26)27)20(25)12-19(17)24/h1,10-12,14H,4-9,13H2,2H3,(H,26,27) |
| InChIKey | ZKZVWOSPOPRDNY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|