C22H27NO4 — CID 142415899
10-methoxy-9-(3-methoxypropoxy)-3-methylspiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-2-one (PubChem CID 142415899) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 10-methoxy-9-(3-methoxypropoxy)-3-methylspiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-2-one.
| Compound Name | 10-methoxy-9-(3-methoxypropoxy)-3-methylspiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-2-one |
|---|---|
| PubChem CID | 142415899 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 10-methoxy-9-(3-methoxypropoxy)-3-methylspiro[7H-benzo[a]quinolizine-6,1'-cyclobutane]-2-one |
| SMILES | COCCCOc1cc2c(cc1OC)-c1cc(=O)c(C)cn1C1(CCC1)C2 |
| InChI | InChI=1S/C22H27NO4/c1-15-14-23-18(12-19(15)24)17-11-20(26-3)21(27-9-5-8-25-2)10-16(17)13-22(23)6-4-7-22/h10-12,14H,4-9,13H2,1-3H3 |
| InChIKey | UIDKOTSOJHURNI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|