C22H30N2O4 — CID 118514449
6-ethyl-10-methoxy-9-(3-methoxypropoxy)-3-(methylaminomethyl)-6,7-dihydrobenzo[a]quinolizin-2-one (PubChem CID 118514449) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 6-ethyl-10-methoxy-9-(3-methoxypropoxy)-3-(methylaminomethyl)-6,7-dihydrobenzo[a]quinolizin-2-one.
| Compound Name | 6-ethyl-10-methoxy-9-(3-methoxypropoxy)-3-(methylaminomethyl)-6,7-dihydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 118514449 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 6-ethyl-10-methoxy-9-(3-methoxypropoxy)-3-(methylaminomethyl)-6,7-dihydrobenzo[a]quinolizin-2-one |
| SMILES | CCC1Cc2cc(OCCCOC)c(OC)cc2-c2cc(=O)c(CNC)cn21 |
| InChI | InChI=1S/C22H30N2O4/c1-5-17-9-15-10-22(28-8-6-7-26-3)21(27-4)11-18(15)19-12-20(25)16(13-23-2)14-24(17)19/h10-12,14,17,23H,5-9,13H2,1-4H3 |
| InChIKey | LTCHJIOBMNJQHJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|