C21H27NO5 — CID 118514440
6-ethyl-3-(hydroxymethyl)-10-methoxy-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one (PubChem CID 118514440) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 6-ethyl-3-(hydroxymethyl)-10-methoxy-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one.
| Compound Name | 6-ethyl-3-(hydroxymethyl)-10-methoxy-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 118514440 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 6-ethyl-3-(hydroxymethyl)-10-methoxy-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one |
| SMILES | CCC1Cc2cc(OCCCOC)c(OC)cc2-c2cc(=O)c(CO)cn21 |
| InChI | InChI=1S/C21H27NO5/c1-4-16-8-14-9-21(27-7-5-6-25-2)20(26-3)10-17(14)18-11-19(24)15(13-23)12-22(16)18/h9-12,16,23H,4-8,13H2,1-3H3 |
| InChIKey | GPXUVVKDUSARDT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|