C23H28N2O6 — CID 118285162
amino 6-cyclobutyl-10-methoxy-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 118285162) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is amino 6-cyclobutyl-10-methoxy-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | amino 6-cyclobutyl-10-methoxy-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 118285162 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | amino 6-cyclobutyl-10-methoxy-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | COCCCOc1cc2c(cc1OC)-c1cc(=O)c(C(=O)ON)cn1C(C1CCC1)C2 |
| InChI | InChI=1S/C23H28N2O6/c1-28-7-4-8-30-22-10-15-9-18(14-5-3-6-14)25-13-17(23(27)31-24)20(26)12-19(25)16(15)11-21(22)29-2/h10-14,18H,3-9,24H2,1-2H3 |
| InChIKey | QCNCYXABAVDXSM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|