C21H26ClNO4 — CID 118514396
1-(chloromethyl)-6-ethyl-10-methoxy-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one (PubChem CID 118514396) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-(chloromethyl)-6-ethyl-10-methoxy-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one.
| Compound Name | 1-(chloromethyl)-6-ethyl-10-methoxy-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 118514396 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-(chloromethyl)-6-ethyl-10-methoxy-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one |
| SMILES | CCC1Cc2cc(OCCCOC)c(OC)cc2-c2c(CCl)c(=O)ccn21 |
| InChI | InChI=1S/C21H26ClNO4/c1-4-15-10-14-11-20(27-9-5-8-25-2)19(26-3)12-16(14)21-17(13-22)18(24)6-7-23(15)21/h6-7,11-12,15H,4-5,8-10,13H2,1-3H3 |
| InChIKey | BLPSGUOIXRIROA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|