C21H27ClN2O3 — CID 142344296
3-amino-6-butyl-10-chloro-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one (PubChem CID 142344296) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 3-amino-6-butyl-10-chloro-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one.
| Compound Name | 3-amino-6-butyl-10-chloro-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 142344296 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-amino-6-butyl-10-chloro-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizin-2-one |
| SMILES | CCCCC1Cc2cc(OCCCOC)c(Cl)cc2-c2cc(=O)c(N)cn21 |
| InChI | InChI=1S/C21H27ClN2O3/c1-3-4-6-15-9-14-10-21(27-8-5-7-26-2)17(22)11-16(14)19-12-20(25)18(23)13-24(15)19/h10-13,15H,3-9,23H2,1-2H3 |
| InChIKey | FDJRJRMUWJEVJE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|