C22H27ClN2O5 — CID 146180915
6-butyl-10-chloro-2-hydroxyimino-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 146180915) has the molecular formula C22H27ClN2O5 and a molecular weight of 434.92 g/mol. Its IUPAC name is 6-butyl-10-chloro-2-hydroxyimino-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | 6-butyl-10-chloro-2-hydroxyimino-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 146180915 |
| Molecular Formula | C22H27ClN2O5 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 6-butyl-10-chloro-2-hydroxyimino-9-(3-methoxypropoxy)-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | CCCCC1Cc2cc(OCCCOC)c(Cl)cc2-c2cc(=NO)c(C(=O)O)cn21 |
| InChI | InChI=1S/C22H27ClN2O5/c1-3-4-6-15-9-14-10-21(30-8-5-7-29-2)18(23)11-16(14)20-12-19(24-28)17(22(26)27)13-25(15)20/h10-13,15,28H,3-9H2,1-2H3,(H,26,27) |
| InChIKey | SSQNIEUMRDCTNL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|