C21H25ClN2O4 — CID 123517560
10-chloro-2-imino-9-(2-methoxyethoxy)-6-(2-methylpropyl)-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 123517560) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 10-chloro-2-imino-9-(2-methoxyethoxy)-6-(2-methylpropyl)-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | 10-chloro-2-imino-9-(2-methoxyethoxy)-6-(2-methylpropyl)-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 123517560 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 10-chloro-2-imino-9-(2-methoxyethoxy)-6-(2-methylpropyl)-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | [H]/N=c1\cc2n(cc1C(=O)O)C(CC(C)C)Cc1cc(OCCOC)c(Cl)cc1-2 |
| InChI | InChI=1S/C21H25ClN2O4/c1-12(2)6-14-7-13-8-20(28-5-4-27-3)17(22)9-15(13)19-10-18(23)16(21(25)26)11-24(14)19/h8-12,14,23H,4-7H2,1-3H3,(H,25,26)/b23-18+ |
| InChIKey | NZHLXCUPADQPIH-PTGBLXJZSA-N |
| XLogP | 4.15 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|