C26H29ClN2O2 — CID 162003801
9-butoxy-6-tert-butyl-10-chloro-3-pyridin-2-yl-6,7-dihydrobenzo[a]quinolizin-2-one (PubChem CID 162003801) has the molecular formula C26H29ClN2O2 and a molecular weight of 436.98 g/mol. Its IUPAC name is 9-butoxy-6-tert-butyl-10-chloro-3-pyridin-2-yl-6,7-dihydrobenzo[a]quinolizin-2-one.
| Compound Name | 9-butoxy-6-tert-butyl-10-chloro-3-pyridin-2-yl-6,7-dihydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 162003801 |
| Molecular Formula | C26H29ClN2O2 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 9-butoxy-6-tert-butyl-10-chloro-3-pyridin-2-yl-6,7-dihydrobenzo[a]quinolizin-2-one |
| SMILES | CCCCOc1cc2c(cc1Cl)-c1cc(=O)c(-c3ccccn3)cn1C(C(C)(C)C)C2 |
| InChI | InChI=1S/C26H29ClN2O2/c1-5-6-11-31-24-12-17-13-25(26(2,3)4)29-16-19(21-9-7-8-10-28-21)23(30)15-22(29)18(17)14-20(24)27/h7-10,12,14-16,25H,5-6,11,13H2,1-4H3 |
| InChIKey | YSOFPGIZSYNGNU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|