C29H40N2O5 — CID 134493521
(2R,6S)-9-(6-aminohexoxy)-16-(3-ethoxyoxiran-2-yl)-10-methoxy-3,3-dimethyl-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaen-15-one (PubChem CID 134493521) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is (2R,6S)-9-(6-aminohexoxy)-16-(3-ethoxyoxiran-2-yl)-10-methoxy-3,3-dimethyl-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaen-15-one.
| Compound Name | (2R,6S)-9-(6-aminohexoxy)-16-(3-ethoxyoxiran-2-yl)-10-methoxy-3,3-dimethyl-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaen-15-one |
|---|---|
| PubChem CID | 134493521 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | (2R,6S)-9-(6-aminohexoxy)-16-(3-ethoxyoxiran-2-yl)-10-methoxy-3,3-dimethyl-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaen-15-one |
| SMILES | CCOC1OC1c1cn2c(cc1=O)-c1cc(OC)c(OCCCCCCN)cc1[C@@H]1CCC(C)(C)[C@@H]12 |
| InChI | InChI=1S/C29H40N2O5/c1-5-34-28-26(36-28)21-17-31-22(16-23(21)32)20-15-24(33-4)25(35-13-9-7-6-8-12-30)14-19(20)18-10-11-29(2,3)27(18)31/h14-18,26-28H,5-13,30H2,1-4H3/t18-,26?,27+,28?/m0/s1 |
| InChIKey | FHFXWQOJAVOHBO-CWQBLVOCSA-N |
| XLogP | 5.31 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|