C25H30FNO5 — CID 130354819
(2S,6R)-16-acetyl-14-fluoro-10-methoxy-9-(3-methoxypropoxy)-3,3-dimethyl-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaen-15-one (PubChem CID 130354819) has the molecular formula C25H30FNO5 and a molecular weight of 443.52 g/mol. Its IUPAC name is (2S,6R)-16-acetyl-14-fluoro-10-methoxy-9-(3-methoxypropoxy)-3,3-dimethyl-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaen-15-one.
| Compound Name | (2S,6R)-16-acetyl-14-fluoro-10-methoxy-9-(3-methoxypropoxy)-3,3-dimethyl-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaen-15-one |
|---|---|
| PubChem CID | 130354819 |
| Molecular Formula | C25H30FNO5 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (2S,6R)-16-acetyl-14-fluoro-10-methoxy-9-(3-methoxypropoxy)-3,3-dimethyl-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaen-15-one |
| SMILES | COCCCOc1cc2c(cc1OC)-c1c(F)c(=O)c(C(C)=O)cn1[C@H]1[C@@H]2CCC1(C)C |
| InChI | InChI=1S/C25H30FNO5/c1-14(28)18-13-27-22(21(26)23(18)29)17-12-19(31-5)20(32-10-6-9-30-4)11-16(17)15-7-8-25(2,3)24(15)27/h11-13,15,24H,6-10H2,1-5H3/t15-,24+/m1/s1 |
| InChIKey | YFAMZOYZUXILCL-MYYSRTQBSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|