C28H37NO7S — CID 159037341
(2R,6S)-10-methoxy-3,3-dimethyl-9-(7-methylsulfonylheptoxy)-15-oxo-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylic acid (PubChem CID 159037341) has the molecular formula C28H37NO7S and a molecular weight of 531.67 g/mol. Its IUPAC name is (2R,6S)-10-methoxy-3,3-dimethyl-9-(7-methylsulfonylheptoxy)-15-oxo-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylic acid.
| Compound Name | (2R,6S)-10-methoxy-3,3-dimethyl-9-(7-methylsulfonylheptoxy)-15-oxo-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylic acid |
|---|---|
| PubChem CID | 159037341 |
| Molecular Formula | C28H37NO7S |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | (2R,6S)-10-methoxy-3,3-dimethyl-9-(7-methylsulfonylheptoxy)-15-oxo-1-azatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13,16-pentaene-16-carboxylic acid |
| SMILES | COc1cc2c(cc1OCCCCCCCS(C)(=O)=O)[C@@H]1CCC(C)(C)[C@@H]1n1cc(C(=O)O)c(=O)cc1-2 |
| InChI | InChI=1S/C28H37NO7S/c1-28(2)11-10-18-19-14-25(36-12-8-6-5-7-9-13-37(4,33)34)24(35-3)15-20(19)22-16-23(30)21(27(31)32)17-29(22)26(18)28/h14-18,26H,5-13H2,1-4H3,(H,31,32)/t18-,26+/m0/s1 |
| InChIKey | OKXWIFPRMQMNKT-HFJWLAOPSA-N |
| XLogP | 5.05 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|