C23H24ClNO5 — CID 146175315
(12bS)-10-chloro-11-(3-methoxypropoxy)-7-oxospiro[1,2,4a,12b-tetrahydropyrrolo[1,2-f]phenanthridine-3,1'-cyclopropane]-6-carboxylic acid (PubChem CID 146175315) has the molecular formula C23H24ClNO5 and a molecular weight of 429.90 g/mol. Its IUPAC name is (12bS)-10-chloro-11-(3-methoxypropoxy)-7-oxospiro[1,2,4a,12b-tetrahydropyrrolo[1,2-f]phenanthridine-3,1'-cyclopropane]-6-carboxylic acid.
| Compound Name | (12bS)-10-chloro-11-(3-methoxypropoxy)-7-oxospiro[1,2,4a,12b-tetrahydropyrrolo[1,2-f]phenanthridine-3,1'-cyclopropane]-6-carboxylic acid |
|---|---|
| PubChem CID | 146175315 |
| Molecular Formula | C23H24ClNO5 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (12bS)-10-chloro-11-(3-methoxypropoxy)-7-oxospiro[1,2,4a,12b-tetrahydropyrrolo[1,2-f]phenanthridine-3,1'-cyclopropane]-6-carboxylic acid |
| SMILES | COCCCOc1cc2c(cc1Cl)C1=CC(=O)C(C(=O)O)=CC1N1[C@H]2CCC12CC2 |
| InChI | InChI=1S/C23H24ClNO5/c1-29-7-2-8-30-21-12-15-13(9-17(21)24)14-11-20(26)16(22(27)28)10-19(14)25-18(15)3-4-23(25)5-6-23/h9-12,18-19H,2-8H2,1H3,(H,27,28)/t18-,19?/m0/s1 |
| InChIKey | SCSULDPROSJFGE-OYKVQYDMSA-N |
| XLogP | 3.78 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|