C13H13NO3 — CID 138525009
3-[(3R)-4-hydroxyhexa-1,5-dien-3-yl]-1,3-benzoxazol-2-one (PubChem CID 138525009) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[(3R)-4-hydroxyhexa-1,5-dien-3-yl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(3R)-4-hydroxyhexa-1,5-dien-3-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 138525009 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-[(3R)-4-hydroxyhexa-1,5-dien-3-yl]-1,3-benzoxazol-2-one |
| SMILES | C=CC(O)[C@@H](C=C)n1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C13H13NO3/c1-3-9(11(15)4-2)14-10-7-5-6-8-12(10)17-13(14)16/h3-9,11,15H,1-2H2/t9-,11?/m1/s1 |
| InChIKey | ZKRPHGSRCVCFPB-BFHBGLAWSA-N |
| XLogP | 1.87 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|