C16H17NO4 — CID 139930642
3-[(2R,3S)-2-ethenyl-3-hydroxyhept-6-enoyl]-1,3-benzoxazol-2-one (PubChem CID 139930642) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-[(2R,3S)-2-ethenyl-3-hydroxyhept-6-enoyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(2R,3S)-2-ethenyl-3-hydroxyhept-6-enoyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 139930642 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-[(2R,3S)-2-ethenyl-3-hydroxyhept-6-enoyl]-1,3-benzoxazol-2-one |
| SMILES | C=CCC[C@H](O)[C@@H](C=C)C(=O)n1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C16H17NO4/c1-3-5-9-13(18)11(4-2)15(19)17-12-8-6-7-10-14(12)21-16(17)20/h3-4,6-8,10-11,13,18H,1-2,5,9H2/t11-,13+/m1/s1 |
| InChIKey | FWQGMSCWZNZKTR-YPMHNXCESA-N |
| XLogP | 2.36 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|