benzyl 2-oxo-1,3-benzoxazole-3-carboxylate

C15H11NO4 — CID 56688108

IUPACbenzyl 2-oxo-1,3-benzoxazole-3-carboxylate
SMILESO=C(OCc1ccccc1)n1c(=O)oc2ccccc21
InChIInChI=1S/C15H11NO4/c17-14(19-10-11-6-2-1-3-7-11)16-12-8-4-5-9-13(12)20-15(16)18/h1-9H,10H2
InChIKeySFLCLOSFHJEHIG-UHFFFAOYSA-N
MW269.26 g/mol
LogP2.78
Rot. Bonds2

About benzyl 2-oxo-1,3-benzoxazole-3-carboxylate

benzyl 2-oxo-1,3-benzoxazole-3-carboxylate (PubChem CID 56688108) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is benzyl 2-oxo-1,3-benzoxazole-3-carboxylate.

Molecular Properties

Compound Namebenzyl 2-oxo-1,3-benzoxazole-3-carboxylate
PubChem CID56688108
Molecular FormulaC15H11NO4
Molecular Weight269.26 g/mol
Exact Mass269.07
IUPAC Namebenzyl 2-oxo-1,3-benzoxazole-3-carboxylate
SMILESO=C(OCc1ccccc1)n1c(=O)oc2ccccc21
InChIInChI=1S/C15H11NO4/c17-14(19-10-11-6-2-1-3-7-11)16-12-8-4-5-9-13(12)20-15(16)18/h1-9H,10H2
InChIKeySFLCLOSFHJEHIG-UHFFFAOYSA-N
XLogP2.78
TPSA61.44 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.26
LogP ≤ 52.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze benzyl 2-oxo-1,3-benzoxazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-oxo-1,3-benzoxazole-3-carboxylate?
The IUPAC name of benzyl 2-oxo-1,3-benzoxazole-3-carboxylate (CID 56688108) is benzyl 2-oxo-1,3-benzoxazole-3-carboxylate.
What is the SMILES notation for benzyl 2-oxo-1,3-benzoxazole-3-carboxylate?
The canonical SMILES for benzyl 2-oxo-1,3-benzoxazole-3-carboxylate is O=C(OCc1ccccc1)n1c(=O)oc2ccccc21.
What is the InChIKey of benzyl 2-oxo-1,3-benzoxazole-3-carboxylate?
The InChIKey is SFLCLOSFHJEHIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO4/c17-14(19-10-11-6-2-1-3-7-11)16-12-8-4-5-9-13(12)20-15(16)18/h1-9H,10H2.
What are the key properties of benzyl 2-oxo-1,3-benzoxazole-3-carboxylate?
benzyl 2-oxo-1,3-benzoxazole-3-carboxylate has a molecular weight of 269.26 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-oxo-1,3-benzoxazole-3-carboxylate is sourced from PubChem (CID 56688108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).