C10H19N — CID 138527540
(7Z)-1,2,2-trimethyl-3,4,5,6-tetrahydroazocine (PubChem CID 138527540) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (7Z)-1,2,2-trimethyl-3,4,5,6-tetrahydroazocine.
| Compound Name | (7Z)-1,2,2-trimethyl-3,4,5,6-tetrahydroazocine |
|---|---|
| PubChem CID | 138527540 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (7Z)-1,2,2-trimethyl-3,4,5,6-tetrahydroazocine |
| SMILES | CN1/C=C\CCCCC1(C)C |
| InChI | InChI=1S/C10H19N/c1-10(2)8-6-4-5-7-9-11(10)3/h7,9H,4-6,8H2,1-3H3/b9-7- |
| InChIKey | DWVRZBBUNDYPEC-CLFYSBASSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |